C16H13NO4 — CID 62019739
4-methoxy-3-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzaldehyde (PubChem CID 62019739) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-methoxy-3-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzaldehyde.
| Compound Name | 4-methoxy-3-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 62019739 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-methoxy-3-[(2-oxo-1,3-benzoxazol-3-yl)methyl]benzaldehyde |
| SMILES | COc1ccc(C=O)cc1Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C16H13NO4/c1-20-14-7-6-11(10-18)8-12(14)9-17-13-4-2-3-5-15(13)21-16(17)19/h2-8,10H,9H2,1H3 |
| InChIKey | QEUMXSIMGXXIFH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|