C15H13NO4 — CID 129087851
6-hydroxy-3-[(2-methoxyphenyl)methyl]-1,3-benzoxazol-2-one (PubChem CID 129087851) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 6-hydroxy-3-[(2-methoxyphenyl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-hydroxy-3-[(2-methoxyphenyl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 129087851 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-hydroxy-3-[(2-methoxyphenyl)methyl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccccc1Cn1c(=O)oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H13NO4/c1-19-13-5-3-2-4-10(13)9-16-12-7-6-11(17)8-14(12)20-15(16)18/h2-8,17H,9H2,1H3 |
| InChIKey | KYYDJGWRTYOOKZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |