2-(3-iodo-4-methylpyrazol-1-yl)acetic acid

C6H7IN2O2 — CID 79787345

IUPAC2-(3-iodo-4-methylpyrazol-1-yl)acetic acid
SMILESCc1cn(CC(=O)O)nc1I
InChIInChI=1S/C6H7IN2O2/c1-4-2-9(3-5(10)11)8-6(4)7/h2H,3H2,1H3,(H,10,11)
InChIKeyXDLCMKVRVLUBDV-UHFFFAOYSA-N
MW266.04 g/mol
LogP0.88
Rot. Bonds2

About 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid

2-(3-iodo-4-methylpyrazol-1-yl)acetic acid (PubChem CID 79787345) has the molecular formula C6H7IN2O2 and a molecular weight of 266.04 g/mol. Its IUPAC name is 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3-iodo-4-methylpyrazol-1-yl)acetic acid
PubChem CID79787345
Molecular FormulaC6H7IN2O2
Molecular Weight266.04 g/mol
Exact Mass265.96
IUPAC Name2-(3-iodo-4-methylpyrazol-1-yl)acetic acid
SMILESCc1cn(CC(=O)O)nc1I
InChIInChI=1S/C6H7IN2O2/c1-4-2-9(3-5(10)11)8-6(4)7/h2H,3H2,1H3,(H,10,11)
InChIKeyXDLCMKVRVLUBDV-UHFFFAOYSA-N
XLogP0.88
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.04
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid?
The IUPAC name of 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid (CID 79787345) is 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid.
What is the SMILES notation for 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid?
The canonical SMILES for 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid is Cc1cn(CC(=O)O)nc1I.
What is the InChIKey of 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid?
The InChIKey is XDLCMKVRVLUBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O2/c1-4-2-9(3-5(10)11)8-6(4)7/h2H,3H2,1H3,(H,10,11).
What are the key properties of 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid?
2-(3-iodo-4-methylpyrazol-1-yl)acetic acid has a molecular weight of 266.04 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodo-4-methylpyrazol-1-yl)acetic acid is sourced from PubChem (CID 79787345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).