C11H9F2IN2 — CID 79787921
1-(2,2-difluoroethyl)-4-(3-iodophenyl)pyrazole (PubChem CID 79787921) has the molecular formula C11H9F2IN2 and a molecular weight of 334.11 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(3-iodophenyl)pyrazole.
| Compound Name | 1-(2,2-difluoroethyl)-4-(3-iodophenyl)pyrazole |
|---|---|
| PubChem CID | 79787921 |
| Molecular Formula | C11H9F2IN2 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(3-iodophenyl)pyrazole |
| SMILES | FC(F)Cn1cc(-c2cccc(I)c2)cn1 |
| InChI | InChI=1S/C11H9F2IN2/c12-11(13)7-16-6-9(5-15-16)8-2-1-3-10(14)4-8/h1-6,11H,7H2 |
| InChIKey | IVNASCTYEJEMAH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|