C10H15F3N2O3 — CID 79791178
3,3,3-trifluoro-2-methyl-2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]propanoic acid (PubChem CID 79791178) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 79791178 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[[1-oxo-1-(prop-2-enylamino)propan-2-yl]amino]propanoic acid |
| SMILES | C=CCNC(=O)C(C)NC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3/c1-4-5-14-7(16)6(2)15-9(3,8(17)18)10(11,12)13/h4,6,15H,1,5H2,2-3H3,(H,14,16)(H,17,18) |
| InChIKey | HFGDIGZUICXDDX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|