About 2-amino-N-butan-2-yl-N,2-dimethylbutanamide
2-amino-N-butan-2-yl-N,2-dimethylbutanamide (PubChem CID 79797343) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-amino-N-butan-2-yl-N,2-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-amino-N-butan-2-yl-N,2-dimethylbutanamide |
| PubChem CID | 79797343 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-amino-N-butan-2-yl-N,2-dimethylbutanamide |
| SMILES | CCC(C)N(C)C(=O)C(C)(N)CC |
| InChI | InChI=1S/C10H22N2O/c1-6-8(3)12(5)9(13)10(4,11)7-2/h8H,6-7,11H2,1-5H3 |
| InChIKey | BTUCVOZZGVDVBQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-butan-2-yl-N,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-butan-2-yl-N,2-dimethylbutanamide?
The IUPAC name of 2-amino-N-butan-2-yl-N,2-dimethylbutanamide (CID 79797343) is 2-amino-N-butan-2-yl-N,2-dimethylbutanamide.
What is the SMILES notation for 2-amino-N-butan-2-yl-N,2-dimethylbutanamide?
The canonical SMILES for 2-amino-N-butan-2-yl-N,2-dimethylbutanamide is CCC(C)N(C)C(=O)C(C)(N)CC.
What is the InChIKey of 2-amino-N-butan-2-yl-N,2-dimethylbutanamide?
The InChIKey is BTUCVOZZGVDVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-6-8(3)12(5)9(13)10(4,11)7-2/h8H,6-7,11H2,1-5H3.
What are the key properties of 2-amino-N-butan-2-yl-N,2-dimethylbutanamide?
2-amino-N-butan-2-yl-N,2-dimethylbutanamide has a molecular weight of 186.30 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-butan-2-yl-N,2-dimethylbutanamide is sourced from PubChem (CID 79797343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).