C11H24N2O — CID 79811320
2-amino-N-(2,2-dimethylpropyl)-N,2-dimethylbutanamide (PubChem CID 79811320) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethylpropyl)-N,2-dimethylbutanamide.
| Compound Name | 2-amino-N-(2,2-dimethylpropyl)-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 79811320 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-amino-N-(2,2-dimethylpropyl)-N,2-dimethylbutanamide |
| SMILES | CCC(C)(N)C(=O)N(C)CC(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-7-11(5,12)9(14)13(6)8-10(2,3)4/h7-8,12H2,1-6H3 |
| InChIKey | PXNITRNAEVGMEQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |