C23H24N4O4 — CID 7979951
N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 7979951) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 7979951 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N'-[4-(2,5-dimethylphenyl)-4-oxobutanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)CCC(=O)c2cc(C)ccc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C23H24N4O4/c1-4-27-23(31)17-8-6-5-7-16(17)21(26-27)22(30)25-24-20(29)12-11-19(28)18-13-14(2)9-10-15(18)3/h5-10,13H,4,11-12H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | LOXOCWKPCPDIGI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|