C13H28N2 — CID 79813270
3-[(3,3-dimethylpiperidin-1-yl)methyl]pentan-3-amine (PubChem CID 79813270) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-[(3,3-dimethylpiperidin-1-yl)methyl]pentan-3-amine.
| Compound Name | 3-[(3,3-dimethylpiperidin-1-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 79813270 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 3-[(3,3-dimethylpiperidin-1-yl)methyl]pentan-3-amine |
| SMILES | CCC(N)(CC)CN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C13H28N2/c1-5-13(14,6-2)11-15-9-7-8-12(3,4)10-15/h5-11,14H2,1-4H3 |
| InChIKey | XZILFYYLVDEITF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |