C16H28N2S — CID 79816498
5-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methylpropyl)pent-3-en-1-amine (PubChem CID 79816498) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is 5-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methylpropyl)pent-3-en-1-amine.
| Compound Name | 5-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methylpropyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79816498 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 5-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methylpropyl)pent-3-en-1-amine |
| SMILES | CC(C)CNCCC=CCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H28N2S/c1-13(2)11-17-10-8-6-7-9-15-18-14(12-19-15)16(3,4)5/h6-7,12-13,17H,8-11H2,1-5H3 |
| InChIKey | MBUWVLHLOXSDMP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|