C12H21NOS — CID 79817868
4-(4-tert-butyl-1,3-thiazol-2-yl)-2-methylbutan-1-ol (PubChem CID 79817868) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 4-(4-tert-butyl-1,3-thiazol-2-yl)-2-methylbutan-1-ol.
| Compound Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 79817868 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-2-methylbutan-1-ol |
| SMILES | CC(CO)CCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C12H21NOS/c1-9(7-14)5-6-11-13-10(8-15-11)12(2,3)4/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | KLUAFMQBOJAGRA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |