C14H24BrNS — CID 79818100
2-(4-bromo-5-methylhexyl)-4-tert-butyl-1,3-thiazole (PubChem CID 79818100) has the molecular formula C14H24BrNS and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-(4-bromo-5-methylhexyl)-4-tert-butyl-1,3-thiazole.
| Compound Name | 2-(4-bromo-5-methylhexyl)-4-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 79818100 |
| Molecular Formula | C14H24BrNS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(4-bromo-5-methylhexyl)-4-tert-butyl-1,3-thiazole |
| SMILES | CC(C)C(Br)CCCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C14H24BrNS/c1-10(2)11(15)7-6-8-13-16-12(9-17-13)14(3,4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | HDYCUIWGSLGPIH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|