C15H16FNOS — CID 79817070
4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-fluorobenzaldehyde (PubChem CID 79817070) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-fluorobenzaldehyde.
| Compound Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 79817070 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-fluorobenzaldehyde |
| SMILES | CC(C)(C)c1csc(Cc2ccc(C=O)c(F)c2)n1 |
| InChI | InChI=1S/C15H16FNOS/c1-15(2,3)13-9-19-14(17-13)7-10-4-5-11(8-18)12(16)6-10/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | NTROLJNKTMBYBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|