About 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one
5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one (PubChem CID 83130975) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one |
| PubChem CID | 83130975 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(Cc2nc(C(C)(C)C)cs2)c[nH]c1=O |
| InChI | InChI=1S/C14H18N2OS/c1-9-5-10(7-15-13(9)17)6-12-16-11(8-18-12)14(2,3)4/h5,7-8H,6H2,1-4H3,(H,15,17) |
| InChIKey | JLQNUAHPTHXNEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one?
The IUPAC name of 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one (CID 83130975) is 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one.
What is the SMILES notation for 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one?
The canonical SMILES for 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one is Cc1cc(Cc2nc(C(C)(C)C)cs2)c[nH]c1=O.
What is the InChIKey of 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one?
The InChIKey is JLQNUAHPTHXNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-9-5-10(7-15-13(9)17)6-12-16-11(8-18-12)14(2,3)4/h5,7-8H,6H2,1-4H3,(H,15,17).
What are the key properties of 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one?
5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one has a molecular weight of 262.38 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-methyl-1H-pyridin-2-one is sourced from PubChem (CID 83130975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).