C12H10ClN5 — CID 79820778
2-(2-amino-4-chlorophenyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79820778) has the molecular formula C12H10ClN5 and a molecular weight of 259.70 g/mol. Its IUPAC name is 2-(2-amino-4-chlorophenyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(2-amino-4-chlorophenyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79820778 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-(2-amino-4-chlorophenyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | Nc1ccc2[nH]c(-c3ccc(Cl)cc3N)nc2n1 |
| InChI | InChI=1S/C12H10ClN5/c13-6-1-2-7(8(14)5-6)11-16-9-3-4-10(15)17-12(9)18-11/h1-5H,14H2,(H3,15,16,17,18) |
| InChIKey | YBQUNBZEUKZKBL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|