C13H12ClN5 — CID 79821124
2-(2-amino-5-chlorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821124) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(2-amino-5-chlorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821124 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CNc1ccc2[nH]c(-c3cc(Cl)ccc3N)nc2n1 |
| InChI | InChI=1S/C13H12ClN5/c1-16-11-5-4-10-13(18-11)19-12(17-10)8-6-7(14)2-3-9(8)15/h2-6H,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | PXRMEWUOLGNVLN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|