C17H17N5O4 — CID 7982385
(1S,5R,6R)-2-amino-4,4-diethoxy-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 7982385) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-4,4-diethoxy-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7982385 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (1S,5R,6R)-2-amino-4,4-diethoxy-6-(2-nitrophenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)N=C(N)[C@@]2(C#N)[C@@H](c3ccccc3[N+](=O)[O-])[C@@]12C#N |
| InChI | InChI=1S/C17H17N5O4/c1-3-25-17(26-4-2)16(10-19)13(15(16,9-18)14(20)21-17)11-7-5-6-8-12(11)22(23)24/h5-8,13H,3-4H2,1-2H3,(H2,20,21)/t13-,15-,16-/m1/s1 |
| InChIKey | MCZLEADVCTVIQS-FVQBIDKESA-N |
| XLogP | 1.81 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|