C14H22N2OS — CID 79824229
3-methyl-3-piperidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-one (PubChem CID 79824229) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-methyl-3-piperidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-one.
| Compound Name | 3-methyl-3-piperidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 79824229 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-methyl-3-piperidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-one |
| SMILES | CCC(C)(C(=O)Cc1nccs1)N1CCCCC1 |
| InChI | InChI=1S/C14H22N2OS/c1-3-14(2,16-8-5-4-6-9-16)12(17)11-13-15-7-10-18-13/h7,10H,3-6,8-9,11H2,1-2H3 |
| InChIKey | NVROWAVRDUDEHJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |