C14H24N2S — CID 79824548
2-tert-butyl-1-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 79824548) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 2-tert-butyl-1-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-1-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79824548 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-tert-butyl-1-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)C1CCCCC1(N)Cc1nccs1 |
| InChI | InChI=1S/C14H24N2S/c1-13(2,3)11-6-4-5-7-14(11,15)10-12-16-8-9-17-12/h8-9,11H,4-7,10,15H2,1-3H3 |
| InChIKey | DIZSIWRJPAGVMB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |