C11H20N4 — CID 79826041
6-N-hexan-3-ylpyridine-2,3,6-triamine (PubChem CID 79826041) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 6-N-hexan-3-ylpyridine-2,3,6-triamine.
| Compound Name | 6-N-hexan-3-ylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79826041 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 6-N-hexan-3-ylpyridine-2,3,6-triamine |
| SMILES | CCCC(CC)Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H20N4/c1-3-5-8(4-2)14-10-7-6-9(12)11(13)15-10/h6-8H,3-5,12H2,1-2H3,(H3,13,14,15) |
| InChIKey | VUNCFJAWNAWDFY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |