C13H18ClNS — CID 79863189
5-(3-chlorophenyl)sulfanyl-2,2-dimethylcyclopentan-1-amine (PubChem CID 79863189) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is 5-(3-chlorophenyl)sulfanyl-2,2-dimethylcyclopentan-1-amine.
| Compound Name | 5-(3-chlorophenyl)sulfanyl-2,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79863189 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(3-chlorophenyl)sulfanyl-2,2-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCC(Sc2cccc(Cl)c2)C1N |
| InChI | InChI=1S/C13H18ClNS/c1-13(2)7-6-11(12(13)15)16-10-5-3-4-9(14)8-10/h3-5,8,11-12H,6-7,15H2,1-2H3 |
| InChIKey | NHQSEPROLBSMRJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |