C8H15ClN2O4S — CID 79864342
2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]propanamide (PubChem CID 79864342) has the molecular formula C8H15ClN2O4S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 79864342 |
| Molecular Formula | C8H15ClN2O4S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C8H15ClN2O4S/c1-6(9)7(12)10-8(13)11(2)4-5-16(3,14)15/h6H,4-5H2,1-3H3,(H,10,12,13) |
| InChIKey | APZTZVHQQBVAJZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|