C7H13ClN2O4S — CID 79864431
2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]acetamide (PubChem CID 79864431) has the molecular formula C7H13ClN2O4S and a molecular weight of 256.71 g/mol. Its IUPAC name is 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 79864431 |
| Molecular Formula | C7H13ClN2O4S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-chloro-N-[methyl(2-methylsulfonylethyl)carbamoyl]acetamide |
| SMILES | CN(CCS(C)(=O)=O)C(=O)NC(=O)CCl |
| InChI | InChI=1S/C7H13ClN2O4S/c1-10(3-4-15(2,13)14)7(12)9-6(11)5-8/h3-5H2,1-2H3,(H,9,11,12) |
| InChIKey | ARMICLGSWYAZCP-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|