C20H22N3O3- — CID 7987082
(4Z)-4-(4-tert-butylphenyl)-4-(pyridine-3-carbonylhydrazinylidene)butanoate (PubChem CID 7987082) has the molecular formula C20H22N3O3- and a molecular weight of 352.41 g/mol. Its IUPAC name is (4Z)-4-(4-tert-butylphenyl)-4-(pyridine-3-carbonylhydrazinylidene)butanoate.
| Compound Name | (4Z)-4-(4-tert-butylphenyl)-4-(pyridine-3-carbonylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 7987082 |
| Molecular Formula | C20H22N3O3- |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4Z)-4-(4-tert-butylphenyl)-4-(pyridine-3-carbonylhydrazinylidene)butanoate |
| SMILES | CC(C)(C)c1ccc(/C(CCC(=O)[O-])=N\NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-20(2,3)16-8-6-14(7-9-16)17(10-11-18(24)25)22-23-19(26)15-5-4-12-21-13-15/h4-9,12-13H,10-11H2,1-3H3,(H,23,26)(H,24,25)/p-1/b22-17- |
| InChIKey | JVEBUCZEMQCBOL-XLNRJJMWSA-M |
| XLogP | 2.04 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|