C8H9N5O — CID 79872887
5-methoxy-2-pyridin-2-yl-1,2,4-triazol-3-amine (PubChem CID 79872887) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-methoxy-2-pyridin-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 5-methoxy-2-pyridin-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 79872887 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 5-methoxy-2-pyridin-2-yl-1,2,4-triazol-3-amine |
| SMILES | COc1nc(N)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C8H9N5O/c1-14-8-11-7(9)13(12-8)6-4-2-3-5-10-6/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | ZIRSRTBDNJPLAH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |