C23H31N4O2+ — CID 7987477
[2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium (PubChem CID 7987477) has the molecular formula C23H31N4O2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is [2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium.
| Compound Name | [2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium |
|---|---|
| PubChem CID | 7987477 |
| Molecular Formula | C23H31N4O2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | [2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]amino]phenyl]methyl-cyclohexyl-methylazanium |
| SMILES | C[NH+](Cc1ccccc1NCC(=O)NNC(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H30N4O2/c1-27(20-13-6-3-7-14-20)17-19-12-8-9-15-21(19)24-16-22(28)25-26-23(29)18-10-4-2-5-11-18/h2,4-5,8-12,15,20,24H,3,6-7,13-14,16-17H2,1H3,(H,25,28)(H,26,29)/p+1 |
| InChIKey | LGVRYRMHGONCJS-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|