C14H19F3N2O2 — CID 79876213
2-(heptan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 79876213) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-(heptan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(heptan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 79876213 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(heptan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | CCCCCC(C)Nc1nc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C14H19F3N2O2/c1-3-4-5-6-9(2)18-12-10(13(20)21)7-8-11(19-12)14(15,16)17/h7-9H,3-6H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | BUYWAVIPMBSFGE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|