C13H18F3N3S — CID 79877381
2-(hexan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79877381) has the molecular formula C13H18F3N3S and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(hexan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-(hexan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877381 |
| Molecular Formula | C13H18F3N3S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(hexan-2-ylamino)-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | CCCCC(C)Nc1nc(C(F)(F)F)ccc1C(N)=S |
| InChI | InChI=1S/C13H18F3N3S/c1-3-4-5-8(2)18-12-9(11(17)20)6-7-10(19-12)13(14,15)16/h6-8H,3-5H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | JQEZFVVGBTVTGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|