C17H27N3S — CID 63519072
2-(heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 63519072) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 2-(heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 2-(heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 63519072 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-(heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | CCCCCC(C)Nc1nc2c(cc1C(N)=S)CCCC2 |
| InChI | InChI=1S/C17H27N3S/c1-3-4-5-8-12(2)19-17-14(16(18)21)11-13-9-6-7-10-15(13)20-17/h11-12H,3-10H2,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | NHARKBYGVHWNTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|