C16H25N3S — CID 104828428
2-(3,3-dimethylbutan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 104828428) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-(3,3-dimethylbutan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 2-(3,3-dimethylbutan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 104828428 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-(3,3-dimethylbutan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | CC(Nc1nc2c(cc1C(N)=S)CCCC2)C(C)(C)C |
| InChI | InChI=1S/C16H25N3S/c1-10(16(2,3)4)18-15-12(14(17)20)9-11-7-5-6-8-13(11)19-15/h9-10H,5-8H2,1-4H3,(H2,17,20)(H,18,19) |
| InChIKey | MVDJOSRGKJETPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|