C16H24N4S — CID 106023919
2-[(1-methylpyrrolidin-2-yl)methylamino]-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 106023919) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-[(1-methylpyrrolidin-2-yl)methylamino]-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 2-[(1-methylpyrrolidin-2-yl)methylamino]-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 106023919 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[(1-methylpyrrolidin-2-yl)methylamino]-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | CN1CCCC1CNc1nc2c(cc1C(N)=S)CCCC2 |
| InChI | InChI=1S/C16H24N4S/c1-20-8-4-6-12(20)10-18-16-13(15(17)21)9-11-5-2-3-7-14(11)19-16/h9,12H,2-8,10H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | AYIYSNCJPNLAGX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|