C14H11F2N3O2 — CID 79881963
2-N-[4-(difluoromethoxy)phenyl]-1,3-benzoxazole-2,6-diamine (PubChem CID 79881963) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-N-[4-(difluoromethoxy)phenyl]-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-[4-(difluoromethoxy)phenyl]-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79881963 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-N-[4-(difluoromethoxy)phenyl]-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3ccc(OC(F)F)cc3)oc2c1 |
| InChI | InChI=1S/C14H11F2N3O2/c15-13(16)20-10-4-2-9(3-5-10)18-14-19-11-6-1-8(17)7-12(11)21-14/h1-7,13H,17H2,(H,18,19) |
| InChIKey | KZTZLZBQERRGNU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|