C9H17NO4S — CID 79887391
2-(5-hydroxypentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79887391) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 2-(5-hydroxypentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-(5-hydroxypentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 79887391 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(5-hydroxypentyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(CCCCCO)S1(=O)=O |
| InChI | InChI=1S/C9H17NO4S/c1-9(2)8(12)10(15(9,13)14)6-4-3-5-7-11/h11H,3-7H2,1-2H3 |
| InChIKey | ZBYWZYSSFPPJGU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|