C12H12F2N2O2 — CID 79888305
2-[3,5-difluoro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine (PubChem CID 79888305) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-difluoro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 79888305 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[3,5-difluoro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(F)c(OCc2ccno2)c(F)c1 |
| InChI | InChI=1S/C12H12F2N2O2/c13-10-5-8(1-3-15)6-11(14)12(10)17-7-9-2-4-16-18-9/h2,4-6H,1,3,7,15H2 |
| InChIKey | IAHHQKNZNIDRRS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |