C16H21F2NO — CID 79895902
N-[(2,4-difluorophenyl)methyl]-6-oxaspiro[4.5]decan-9-amine (PubChem CID 79895902) has the molecular formula C16H21F2NO and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-6-oxaspiro[4.5]decan-9-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-6-oxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79895902 |
| Molecular Formula | C16H21F2NO |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-6-oxaspiro[4.5]decan-9-amine |
| SMILES | Fc1ccc(CNC2CCOC3(CCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C16H21F2NO/c17-13-4-3-12(15(18)9-13)11-19-14-5-8-20-16(10-14)6-1-2-7-16/h3-4,9,14,19H,1-2,5-8,10-11H2 |
| InChIKey | RDVPPKVQIHWPEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |