C10H10F4N2O2S — CID 79904407
N-[(1,1-dioxothiolan-3-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 79904407) has the molecular formula C10H10F4N2O2S and a molecular weight of 298.26 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 79904407 |
| Molecular Formula | C10H10F4N2O2S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | O=S1(=O)CCC(CNc2c(F)c(F)nc(F)c2F)C1 |
| InChI | InChI=1S/C10H10F4N2O2S/c11-6-8(7(12)10(14)16-9(6)13)15-3-5-1-2-19(17,18)4-5/h5H,1-4H2,(H,15,16) |
| InChIKey | REMKXCHBBYKCBJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|