C19H25N3O4 — CID 7993066
(2S)-2-(4-cyano-2-ethoxyphenoxy)-N-(cyclohexylcarbamoyl)propanamide (PubChem CID 7993066) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (2S)-2-(4-cyano-2-ethoxyphenoxy)-N-(cyclohexylcarbamoyl)propanamide.
| Compound Name | (2S)-2-(4-cyano-2-ethoxyphenoxy)-N-(cyclohexylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 7993066 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (2S)-2-(4-cyano-2-ethoxyphenoxy)-N-(cyclohexylcarbamoyl)propanamide |
| SMILES | CCOc1cc(C#N)ccc1O[C@@H](C)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-25-17-11-14(12-20)9-10-16(17)26-13(2)18(23)22-19(24)21-15-7-5-4-6-8-15/h9-11,13,15H,3-8H2,1-2H3,(H2,21,22,23,24)/t13-/m0/s1 |
| InChIKey | CEAFRDBEKJLQIB-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |