C17H30N2O2 — CID 79933142
3-methyl-1-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 79933142) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-methyl-1-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-1-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79933142 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-methyl-1-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(CN2CC3CCCN3CC2C)(C(=O)O)C1 |
| InChI | InChI=1S/C17H30N2O2/c1-13-5-3-7-17(9-13,16(20)21)12-19-11-15-6-4-8-18(15)10-14(19)2/h13-15H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | CDSGAVDZSYMQFZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |