C14H24N4S — CID 79934712
1-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 79934712) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 79934712 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylmethyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | CC(N)c1nc(CN2CCN3CCCCC3C2)cs1 |
| InChI | InChI=1S/C14H24N4S/c1-11(15)14-16-12(10-19-14)8-17-6-7-18-5-3-2-4-13(18)9-17/h10-11,13H,2-9,15H2,1H3 |
| InChIKey | NHVIEBSKVMNKJC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |