C9H14N2O3 — CID 79937304
1-ethyl-4-(oxiran-2-ylmethyl)piperazine-2,5-dione (PubChem CID 79937304) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-ethyl-4-(oxiran-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 1-ethyl-4-(oxiran-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 79937304 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-ethyl-4-(oxiran-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CCN1CC(=O)N(CC2CO2)CC1=O |
| InChI | InChI=1S/C9H14N2O3/c1-2-10-4-9(13)11(5-8(10)12)3-7-6-14-7/h7H,2-6H2,1H3 |
| InChIKey | KTHNDSCTOLSOED-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|