C13H24OS — CID 79947542
3-(cyclopentylmethyl)-5,5-dimethylthian-3-ol (PubChem CID 79947542) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-5,5-dimethylthian-3-ol.
| Compound Name | 3-(cyclopentylmethyl)-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79947542 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-(cyclopentylmethyl)-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(CC2CCCC2)C1 |
| InChI | InChI=1S/C13H24OS/c1-12(2)8-13(14,10-15-9-12)7-11-5-3-4-6-11/h11,14H,3-10H2,1-2H3 |
| InChIKey | GWHZVASMUIBHNO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |