C16H18BrNO2S — CID 79954285
11-(2-bromophenyl)-1-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione (PubChem CID 79954285) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 11-(2-bromophenyl)-1-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 11-(2-bromophenyl)-1-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 79954285 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 11-(2-bromophenyl)-1-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC1SCCCC12CC(=O)NC(=O)C2c1ccccc1Br |
| InChI | InChI=1S/C16H18BrNO2S/c1-10-16(7-4-8-21-10)9-13(19)18-15(20)14(16)11-5-2-3-6-12(11)17/h2-3,5-6,10,14H,4,7-9H2,1H3,(H,18,19,20) |
| InChIKey | RIFQANATCMMMHO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|