C10H19NS — CID 79956087
3-(4,4-dimethylthian-3-ylidene)propan-1-amine (PubChem CID 79956087) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 3-(4,4-dimethylthian-3-ylidene)propan-1-amine.
| Compound Name | 3-(4,4-dimethylthian-3-ylidene)propan-1-amine |
|---|---|
| PubChem CID | 79956087 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-(4,4-dimethylthian-3-ylidene)propan-1-amine |
| SMILES | CC1(C)CCSCC1=CCCN |
| InChI | InChI=1S/C10H19NS/c1-10(2)5-7-12-8-9(10)4-3-6-11/h4H,3,5-8,11H2,1-2H3 |
| InChIKey | DPRBVBYCHYDHGG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|