C14H22N2O2S2 — CID 79956480
N,4-dimethyl-3-[(2-methylthian-3-yl)amino]benzenesulfonamide (PubChem CID 79956480) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is N,4-dimethyl-3-[(2-methylthian-3-yl)amino]benzenesulfonamide.
| Compound Name | N,4-dimethyl-3-[(2-methylthian-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79956480 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N,4-dimethyl-3-[(2-methylthian-3-yl)amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(NC2CCCSC2C)c1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-10-6-7-12(20(17,18)15-3)9-14(10)16-13-5-4-8-19-11(13)2/h6-7,9,11,13,15-16H,4-5,8H2,1-3H3 |
| InChIKey | ZKJUWCWASFONMK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |