C11H18N2S2 — CID 79957326
2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]thian-3-amine (PubChem CID 79957326) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]thian-3-amine.
| Compound Name | 2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]thian-3-amine |
|---|---|
| PubChem CID | 79957326 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-methyl-N-[2-(1,3-thiazol-2-yl)ethyl]thian-3-amine |
| SMILES | CC1SCCCC1NCCc1nccs1 |
| InChI | InChI=1S/C11H18N2S2/c1-9-10(3-2-7-14-9)12-5-4-11-13-6-8-15-11/h6,8-10,12H,2-5,7H2,1H3 |
| InChIKey | ZASDKHRVNJLSFA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |