C16H21N3S — CID 79957974
N-[4-(1H-imidazol-5-yl)phenyl]-5,5-dimethylthian-3-amine (PubChem CID 79957974) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[4-(1H-imidazol-5-yl)phenyl]-5,5-dimethylthian-3-amine.
| Compound Name | N-[4-(1H-imidazol-5-yl)phenyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79957974 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[4-(1H-imidazol-5-yl)phenyl]-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(Nc2ccc(-c3cnc[nH]3)cc2)C1 |
| InChI | InChI=1S/C16H21N3S/c1-16(2)7-14(9-20-10-16)19-13-5-3-12(4-6-13)15-8-17-11-18-15/h3-6,8,11,14,19H,7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | SSIYXXDFENDCBK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |