C10H17N3O — CID 79959493
4-amino-1-methyl-1,3-diazaspiro[4.6]undec-3-en-2-one (PubChem CID 79959493) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-amino-1-methyl-1,3-diazaspiro[4.6]undec-3-en-2-one.
| Compound Name | 4-amino-1-methyl-1,3-diazaspiro[4.6]undec-3-en-2-one |
|---|---|
| PubChem CID | 79959493 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-amino-1-methyl-1,3-diazaspiro[4.6]undec-3-en-2-one |
| SMILES | CN1C(=O)N=C(N)C12CCCCCC2 |
| InChI | InChI=1S/C10H17N3O/c1-13-9(14)12-8(11)10(13)6-4-2-3-5-7-10/h2-7H2,1H3,(H2,11,12,14) |
| InChIKey | IBBBRUWMFXTBGG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |