C11H21N3O — CID 79959264
4-amino-5-hexyl-1,5-dimethylimidazol-2-one (PubChem CID 79959264) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-amino-5-hexyl-1,5-dimethylimidazol-2-one.
| Compound Name | 4-amino-5-hexyl-1,5-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 79959264 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-amino-5-hexyl-1,5-dimethylimidazol-2-one |
| SMILES | CCCCCCC1(C)C(N)=NC(=O)N1C |
| InChI | InChI=1S/C11H21N3O/c1-4-5-6-7-8-11(2)9(12)13-10(15)14(11)3/h4-8H2,1-3H3,(H2,12,13,15) |
| InChIKey | WWSWVJKLSZETSW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|