C17H18N2O — CID 79960184
1,4-diazabicyclo[2.2.2]octan-2-yl(naphthalen-1-yl)methanone (PubChem CID 79960184) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octan-2-yl(naphthalen-1-yl)methanone.
| Compound Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(naphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 79960184 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(naphthalen-1-yl)methanone |
| SMILES | O=C(c1cccc2ccccc12)C1CN2CCN1CC2 |
| InChI | InChI=1S/C17H18N2O/c20-17(16-12-18-8-10-19(16)11-9-18)15-7-3-5-13-4-1-2-6-14(13)15/h1-7,16H,8-12H2 |
| InChIKey | JXIXBAPLFVZVGH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |