C19H23NO — CID 144874180
naphthalen-1-yl-(1-propan-2-ylpiperidin-4-yl)methanone (PubChem CID 144874180) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is naphthalen-1-yl-(1-propan-2-ylpiperidin-4-yl)methanone.
| Compound Name | naphthalen-1-yl-(1-propan-2-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 144874180 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | naphthalen-1-yl-(1-propan-2-ylpiperidin-4-yl)methanone |
| SMILES | CC(C)N1CCC(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C19H23NO/c1-14(2)20-12-10-16(11-13-20)19(21)18-9-5-7-15-6-3-4-8-17(15)18/h3-9,14,16H,10-13H2,1-2H3 |
| InChIKey | KNFBXKYNXWMJMX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |